C23H34O4 — CID 146166969
(1R,4aS,10aR)-1-ethenyl-4a-[(1S)-1-(methoxymethoxy)prop-2-enyl]spiro[1,2,3,4,5,6,8,9,10,10a-decahydrophenanthrene-7,2'-1,3-dioxolane] (PubChem CID 146166969) has the molecular formula C23H34O4 and a molecular weight of 374.52 g/mol. Its IUPAC name is (1R,4aS,10aR)-1-ethenyl-4a-[(1S)-1-(methoxymethoxy)prop-2-enyl]spiro[1,2,3,4,5,6,8,9,10,10a-decahydrophenanthrene-7,2'-1,3-dioxolane].
| Compound Name | (1R,4aS,10aR)-1-ethenyl-4a-[(1S)-1-(methoxymethoxy)prop-2-enyl]spiro[1,2,3,4,5,6,8,9,10,10a-decahydrophenanthrene-7,2'-1,3-dioxolane] |
|---|---|
| PubChem CID | 146166969 |
| Molecular Formula | C23H34O4 |
| Molecular Weight | 374.52 g/mol |
| Exact Mass | 374.25 |
| IUPAC Name | (1R,4aS,10aR)-1-ethenyl-4a-[(1S)-1-(methoxymethoxy)prop-2-enyl]spiro[1,2,3,4,5,6,8,9,10,10a-decahydrophenanthrene-7,2'-1,3-dioxolane] |
| SMILES | C=C[C@H](OCOC)[C@@]12CCC[C@H](C=C)[C@H]1CCC1=C2CCC2(C1)OCCO2 |
| InChI | InChI=1S/C23H34O4/c1-4-17-7-6-11-23(21(5-2)25-16-24-3)19(17)9-8-18-15-22(12-10-20(18)23)26-13-14-27-22/h4-5,17,19,21H,1-2,6-16H2,3H3/t17-,19+,21-,23-/m0/s1 |
| InChIKey | LAWWPBZEFSFDCE-FTJYFCJYSA-N |
| XLogP | 4.77 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.52 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|