About 3-[(2S,3R)-2-(dimethylamino)-3-thiophen-2-ylpent-4-enoyl]-1,3-oxazolidin-2-one
3-[(2S,3R)-2-(dimethylamino)-3-thiophen-2-ylpent-4-enoyl]-1,3-oxazolidin-2-one (PubChem CID 146166989) has the molecular formula C14H18N2O3S
and a molecular weight of 294.38 g/mol. Its IUPAC name is 3-[(2S,3R)-2-(dimethylamino)-3-thiophen-2-ylpent-4-enoyl]-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | 3-[(2S,3R)-2-(dimethylamino)-3-thiophen-2-ylpent-4-enoyl]-1,3-oxazolidin-2-one |
| PubChem CID | 146166989 |
| Molecular Formula | C14H18N2O3S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 3-[(2S,3R)-2-(dimethylamino)-3-thiophen-2-ylpent-4-enoyl]-1,3-oxazolidin-2-one |
| SMILES | C=C[C@@H](c1cccs1)[C@@H](C(=O)N1CCOC1=O)N(C)C |
| InChI | InChI=1S/C14H18N2O3S/c1-4-10(11-6-5-9-20-11)12(15(2)3)13(17)16-7-8-19-14(16)18/h4-6,9-10,12H,1,7-8H2,2-3H3/t10-,12-/m0/s1 |
| InChIKey | YXJJGBRESZQCPF-JQWIXIFHSA-N |
| XLogP | 1.93 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-[(2S,3R)-2-(dimethylamino)-3-thiophen-2-ylpent-4-enoyl]-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2S,3R)-2-(dimethylamino)-3-thiophen-2-ylpent-4-enoyl]-1,3-oxazolidin-2-one?
The IUPAC name of 3-[(2S,3R)-2-(dimethylamino)-3-thiophen-2-ylpent-4-enoyl]-1,3-oxazolidin-2-one (CID 146166989) is 3-[(2S,3R)-2-(dimethylamino)-3-thiophen-2-ylpent-4-enoyl]-1,3-oxazolidin-2-one.
What is the SMILES notation for 3-[(2S,3R)-2-(dimethylamino)-3-thiophen-2-ylpent-4-enoyl]-1,3-oxazolidin-2-one?
The canonical SMILES for 3-[(2S,3R)-2-(dimethylamino)-3-thiophen-2-ylpent-4-enoyl]-1,3-oxazolidin-2-one is C=C[C@@H](c1cccs1)[C@@H](C(=O)N1CCOC1=O)N(C)C.
What is the InChIKey of 3-[(2S,3R)-2-(dimethylamino)-3-thiophen-2-ylpent-4-enoyl]-1,3-oxazolidin-2-one?
The InChIKey is YXJJGBRESZQCPF-JQWIXIFHSA-N. The full InChI is InChI=1S/C14H18N2O3S/c1-4-10(11-6-5-9-20-11)12(15(2)3)13(17)16-7-8-19-14(16)18/h4-6,9-10,12H,1,7-8H2,2-3H3/t10-,12-/m0/s1.
What are the key properties of 3-[(2S,3R)-2-(dimethylamino)-3-thiophen-2-ylpent-4-enoyl]-1,3-oxazolidin-2-one?
3-[(2S,3R)-2-(dimethylamino)-3-thiophen-2-ylpent-4-enoyl]-1,3-oxazolidin-2-one has a molecular weight of 294.38 g/mol, XLogP of 1.93, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2S,3R)-2-(dimethylamino)-3-thiophen-2-ylpent-4-enoyl]-1,3-oxazolidin-2-one is sourced from PubChem (CID 146166989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).