C11H12 — CID 146167076
(5Z)-5-ethenylnona-1,5,8-trien-3-yne (PubChem CID 146167076) has the molecular formula C11H12 and a molecular weight of 144.22 g/mol. Its IUPAC name is (5Z)-5-ethenylnona-1,5,8-trien-3-yne.
| Compound Name | (5Z)-5-ethenylnona-1,5,8-trien-3-yne |
|---|---|
| PubChem CID | 146167076 |
| Molecular Formula | C11H12 |
| Molecular Weight | 144.22 g/mol |
| Exact Mass | 144.09 |
| IUPAC Name | (5Z)-5-ethenylnona-1,5,8-trien-3-yne |
| SMILES | C=CC#C/C(C=C)=C\CC=C |
| InChI | InChI=1S/C11H12/c1-4-7-9-11(6-3)10-8-5-2/h4-6,9H,1-3,7H2/b11-9- |
| InChIKey | DLSCSBSTRWJSFP-LUAWRHEFSA-N |
| XLogP | 2.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.22 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|