About N-[1-[2-(2,4-difluorophenyl)-2-fluoroethyl]piperidin-4-yl]-N-phenylpropanamide
N-[1-[2-(2,4-difluorophenyl)-2-fluoroethyl]piperidin-4-yl]-N-phenylpropanamide (PubChem CID 146167149) has the molecular formula C22H25F3N2O
and a molecular weight of 390.45 g/mol. Its IUPAC name is N-[1-[2-(2,4-difluorophenyl)-2-fluoroethyl]piperidin-4-yl]-N-phenylpropanamide.
Molecular Properties
| Compound Name | N-[1-[2-(2,4-difluorophenyl)-2-fluoroethyl]piperidin-4-yl]-N-phenylpropanamide |
| PubChem CID | 146167149 |
| Molecular Formula | C22H25F3N2O |
| Molecular Weight | 390.45 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | N-[1-[2-(2,4-difluorophenyl)-2-fluoroethyl]piperidin-4-yl]-N-phenylpropanamide |
| SMILES | CCC(=O)N(c1ccccc1)C1CCN(CC(F)c2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C22H25F3N2O/c1-2-22(28)27(17-6-4-3-5-7-17)18-10-12-26(13-11-18)15-21(25)19-9-8-16(23)14-20(19)24/h3-9,14,18,21H,2,10-13,15H2,1H3 |
| InChIKey | FJXRHQMYUOVNNB-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.45 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[1-[2-(2,4-difluorophenyl)-2-fluoroethyl]piperidin-4-yl]-N-phenylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-[2-(2,4-difluorophenyl)-2-fluoroethyl]piperidin-4-yl]-N-phenylpropanamide?
The IUPAC name of N-[1-[2-(2,4-difluorophenyl)-2-fluoroethyl]piperidin-4-yl]-N-phenylpropanamide (CID 146167149) is N-[1-[2-(2,4-difluorophenyl)-2-fluoroethyl]piperidin-4-yl]-N-phenylpropanamide.
What is the SMILES notation for N-[1-[2-(2,4-difluorophenyl)-2-fluoroethyl]piperidin-4-yl]-N-phenylpropanamide?
The canonical SMILES for N-[1-[2-(2,4-difluorophenyl)-2-fluoroethyl]piperidin-4-yl]-N-phenylpropanamide is CCC(=O)N(c1ccccc1)C1CCN(CC(F)c2ccc(F)cc2F)CC1.
What is the InChIKey of N-[1-[2-(2,4-difluorophenyl)-2-fluoroethyl]piperidin-4-yl]-N-phenylpropanamide?
The InChIKey is FJXRHQMYUOVNNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25F3N2O/c1-2-22(28)27(17-6-4-3-5-7-17)18-10-12-26(13-11-18)15-21(25)19-9-8-16(23)14-20(19)24/h3-9,14,18,21H,2,10-13,15H2,1H3.
What are the key properties of N-[1-[2-(2,4-difluorophenyl)-2-fluoroethyl]piperidin-4-yl]-N-phenylpropanamide?
N-[1-[2-(2,4-difluorophenyl)-2-fluoroethyl]piperidin-4-yl]-N-phenylpropanamide has a molecular weight of 390.45 g/mol, XLogP of 4.88, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-[2-(2,4-difluorophenyl)-2-fluoroethyl]piperidin-4-yl]-N-phenylpropanamide is sourced from PubChem (CID 146167149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).