C30H32N2O5 — CID 146167187
(2R,3R,4R)-2,3-bis(phenylmethoxy)-4-(phenylmethoxymethyl)-1,2,3,4,7,8-hexahydropyridazino[1,2-a]pyridazine-6,9-dione (PubChem CID 146167187) has the molecular formula C30H32N2O5 and a molecular weight of 500.60 g/mol. Its IUPAC name is (2R,3R,4R)-2,3-bis(phenylmethoxy)-4-(phenylmethoxymethyl)-1,2,3,4,7,8-hexahydropyridazino[1,2-a]pyridazine-6,9-dione.
| Compound Name | (2R,3R,4R)-2,3-bis(phenylmethoxy)-4-(phenylmethoxymethyl)-1,2,3,4,7,8-hexahydropyridazino[1,2-a]pyridazine-6,9-dione |
|---|---|
| PubChem CID | 146167187 |
| Molecular Formula | C30H32N2O5 |
| Molecular Weight | 500.60 g/mol |
| Exact Mass | 500.23 |
| IUPAC Name | (2R,3R,4R)-2,3-bis(phenylmethoxy)-4-(phenylmethoxymethyl)-1,2,3,4,7,8-hexahydropyridazino[1,2-a]pyridazine-6,9-dione |
| SMILES | O=C1CCC(=O)N2[C@H](COCc3ccccc3)[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)CN12 |
| InChI | InChI=1S/C30H32N2O5/c33-28-16-17-29(34)32-26(22-35-19-23-10-4-1-5-11-23)30(37-21-25-14-8-3-9-15-25)27(18-31(28)32)36-20-24-12-6-2-7-13-24/h1-15,26-27,30H,16-22H2/t26-,27-,30-/m1/s1 |
| InChIKey | NDUDRIMLIWUDEE-YCVRVPNXSA-N |
| XLogP | 4.12 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.60 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |