C29H33N3O4 — CID 146167190
(NZ)-N-[(5R,6R,7R)-6,7-bis(phenylmethoxy)-5-(phenylmethoxymethyl)-2,3,5,6,7,8-hexahydropyrazolo[1,2-a]pyridazin-1-ylidene]hydroxylamine (PubChem CID 146167190) has the molecular formula C29H33N3O4 and a molecular weight of 487.60 g/mol. Its IUPAC name is (NZ)-N-[(5R,6R,7R)-6,7-bis(phenylmethoxy)-5-(phenylmethoxymethyl)-2,3,5,6,7,8-hexahydropyrazolo[1,2-a]pyridazin-1-ylidene]hydroxylamine.
| Compound Name | (NZ)-N-[(5R,6R,7R)-6,7-bis(phenylmethoxy)-5-(phenylmethoxymethyl)-2,3,5,6,7,8-hexahydropyrazolo[1,2-a]pyridazin-1-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 146167190 |
| Molecular Formula | C29H33N3O4 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.25 |
| IUPAC Name | (NZ)-N-[(5R,6R,7R)-6,7-bis(phenylmethoxy)-5-(phenylmethoxymethyl)-2,3,5,6,7,8-hexahydropyrazolo[1,2-a]pyridazin-1-ylidene]hydroxylamine |
| SMILES | O/N=C1/CCN2[C@H](COCc3ccccc3)[C@@H](OCc3ccccc3)C(OCc3ccccc3)CN12 |
| InChI | InChI=1S/C29H33N3O4/c33-30-28-16-17-31-26(22-34-19-23-10-4-1-5-11-23)29(36-21-25-14-8-3-9-15-25)27(18-32(28)31)35-20-24-12-6-2-7-13-24/h1-15,26-27,29,33H,16-22H2/b30-28-/t26-,27?,29-/m1/s1 |
| InChIKey | NZTPFRUUULXRJW-BXUZETIASA-N |
| XLogP | 4.47 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|