C22H18FNO3 — CID 146167265
benzyl N-[4-(5-acetyl-2-fluorophenyl)phenyl]carbamate (PubChem CID 146167265) has the molecular formula C22H18FNO3 and a molecular weight of 363.39 g/mol. Its IUPAC name is benzyl N-[4-(5-acetyl-2-fluorophenyl)phenyl]carbamate.
| Compound Name | benzyl N-[4-(5-acetyl-2-fluorophenyl)phenyl]carbamate |
|---|---|
| PubChem CID | 146167265 |
| Molecular Formula | C22H18FNO3 |
| Molecular Weight | 363.39 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | benzyl N-[4-(5-acetyl-2-fluorophenyl)phenyl]carbamate |
| SMILES | CC(=O)c1ccc(F)c(-c2ccc(NC(=O)OCc3ccccc3)cc2)c1 |
| InChI | InChI=1S/C22H18FNO3/c1-15(25)18-9-12-21(23)20(13-18)17-7-10-19(11-8-17)24-22(26)27-14-16-5-3-2-4-6-16/h2-13H,14H2,1H3,(H,24,26) |
| InChIKey | SNYOFKLENYPYPL-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.39 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |