C16H18F2O4S — CID 146167282
methyl 2-(2-ethoxy-1,1-difluoro-2-oxoethyl)sulfanyl-2-phenylpent-4-enoate (PubChem CID 146167282) has the molecular formula C16H18F2O4S and a molecular weight of 344.38 g/mol. Its IUPAC name is methyl 2-(2-ethoxy-1,1-difluoro-2-oxoethyl)sulfanyl-2-phenylpent-4-enoate.
| Compound Name | methyl 2-(2-ethoxy-1,1-difluoro-2-oxoethyl)sulfanyl-2-phenylpent-4-enoate |
|---|---|
| PubChem CID | 146167282 |
| Molecular Formula | C16H18F2O4S |
| Molecular Weight | 344.38 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | methyl 2-(2-ethoxy-1,1-difluoro-2-oxoethyl)sulfanyl-2-phenylpent-4-enoate |
| SMILES | C=CCC(SC(F)(F)C(=O)OCC)(C(=O)OC)c1ccccc1 |
| InChI | InChI=1S/C16H18F2O4S/c1-4-11-15(13(19)21-3,12-9-7-6-8-10-12)23-16(17,18)14(20)22-5-2/h4,6-10H,1,5,11H2,2-3H3 |
| InChIKey | IDFGBDGIOWJFFA-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.38 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|