C24H32O8 — CID 146167314
(7S,8S)-5,8-bis(2-hydroxybut-3-enyl)-3,3,10,10-tetramethoxytricyclo[6.2.2.02,7]dodeca-5,11-diene-4,9-dione (PubChem CID 146167314) has the molecular formula C24H32O8 and a molecular weight of 448.51 g/mol. Its IUPAC name is (7S,8S)-5,8-bis(2-hydroxybut-3-enyl)-3,3,10,10-tetramethoxytricyclo[6.2.2.02,7]dodeca-5,11-diene-4,9-dione.
| Compound Name | (7S,8S)-5,8-bis(2-hydroxybut-3-enyl)-3,3,10,10-tetramethoxytricyclo[6.2.2.02,7]dodeca-5,11-diene-4,9-dione |
|---|---|
| PubChem CID | 146167314 |
| Molecular Formula | C24H32O8 |
| Molecular Weight | 448.51 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | (7S,8S)-5,8-bis(2-hydroxybut-3-enyl)-3,3,10,10-tetramethoxytricyclo[6.2.2.02,7]dodeca-5,11-diene-4,9-dione |
| SMILES | C=CC(O)CC1=C[C@H]2C(C3C=C[C@]2(CC(O)C=C)C(=O)C3(OC)OC)C(OC)(OC)C1=O |
| InChI | InChI=1S/C24H32O8/c1-7-15(25)11-14-12-18-19(24(31-5,32-6)20(14)27)17-9-10-22(18,13-16(26)8-2)21(28)23(17,29-3)30-4/h7-10,12,15-19,25-26H,1-2,11,13H2,3-6H3/t15?,16?,17?,18-,19?,22+/m0/s1 |
| InChIKey | CENCAEGSRZTUAI-WRIJVJTLSA-N |
| XLogP | 1.34 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.51 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|