C17H12ClF3N4O2 — CID 146167536
N-(3-amino-5-chlorophenyl)-1-(4-hydroxyphenyl)-5-(trifluoromethyl)pyrazole-4-carboxamide (PubChem CID 146167536) has the molecular formula C17H12ClF3N4O2 and a molecular weight of 396.76 g/mol. Its IUPAC name is N-(3-amino-5-chlorophenyl)-1-(4-hydroxyphenyl)-5-(trifluoromethyl)pyrazole-4-carboxamide.
| Compound Name | N-(3-amino-5-chlorophenyl)-1-(4-hydroxyphenyl)-5-(trifluoromethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 146167536 |
| Molecular Formula | C17H12ClF3N4O2 |
| Molecular Weight | 396.76 g/mol |
| Exact Mass | 396.06 |
| IUPAC Name | N-(3-amino-5-chlorophenyl)-1-(4-hydroxyphenyl)-5-(trifluoromethyl)pyrazole-4-carboxamide |
| SMILES | Nc1cc(Cl)cc(NC(=O)c2cnn(-c3ccc(O)cc3)c2C(F)(F)F)c1 |
| InChI | InChI=1S/C17H12ClF3N4O2/c18-9-5-10(22)7-11(6-9)24-16(27)14-8-23-25(15(14)17(19,20)21)12-1-3-13(26)4-2-12/h1-8,26H,22H2,(H,24,27) |
| InChIKey | HSNZMXWPNZXGOS-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 93.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.76 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|