C13H18S — CID 146167546
spiro[6-thiatricyclo[3.2.2.02,4]non-8-ene-7,1'-cyclohexane] (PubChem CID 146167546) has the molecular formula C13H18S and a molecular weight of 206.35 g/mol. Its IUPAC name is spiro[6-thiatricyclo[3.2.2.02,4]non-8-ene-7,1'-cyclohexane].
| Compound Name | spiro[6-thiatricyclo[3.2.2.02,4]non-8-ene-7,1'-cyclohexane] |
|---|---|
| PubChem CID | 146167546 |
| Molecular Formula | C13H18S |
| Molecular Weight | 206.35 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | spiro[6-thiatricyclo[3.2.2.02,4]non-8-ene-7,1'-cyclohexane] |
| SMILES | C1=CC2C3CC3C1SC21CCCCC1 |
| InChI | InChI=1S/C13H18S/c1-2-6-13(7-3-1)11-4-5-12(14-13)10-8-9(10)11/h4-5,9-12H,1-3,6-8H2 |
| InChIKey | LELTXJRSHWQPEV-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.35 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|