About (2R,3R)-3-(6-methoxy-3-pyridinyl)-2-prop-1-en-2-ylbutane-1,3-diol
(2R,3R)-3-(6-methoxy-3-pyridinyl)-2-prop-1-en-2-ylbutane-1,3-diol (PubChem CID 146167568) has the molecular formula C13H19NO3
and a molecular weight of 237.30 g/mol. Its IUPAC name is (2R,3R)-3-(6-methoxy-3-pyridinyl)-2-prop-1-en-2-ylbutane-1,3-diol.
Molecular Properties
| Compound Name | (2R,3R)-3-(6-methoxy-3-pyridinyl)-2-prop-1-en-2-ylbutane-1,3-diol |
| PubChem CID | 146167568 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | (2R,3R)-3-(6-methoxy-3-pyridinyl)-2-prop-1-en-2-ylbutane-1,3-diol |
| SMILES | C=C(C)[C@H](CO)[C@@](C)(O)c1ccc(OC)nc1 |
| InChI | InChI=1S/C13H19NO3/c1-9(2)11(8-15)13(3,16)10-5-6-12(17-4)14-7-10/h5-7,11,15-16H,1,8H2,2-4H3/t11-,13-/m0/s1 |
| InChIKey | BPCLIMIUGBFFOH-AAEUAGOBSA-N |
| XLogP | 1.48 |
| TPSA | 62.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2R,3R)-3-(6-methoxy-3-pyridinyl)-2-prop-1-en-2-ylbutane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3R)-3-(6-methoxy-3-pyridinyl)-2-prop-1-en-2-ylbutane-1,3-diol?
The IUPAC name of (2R,3R)-3-(6-methoxy-3-pyridinyl)-2-prop-1-en-2-ylbutane-1,3-diol (CID 146167568) is (2R,3R)-3-(6-methoxy-3-pyridinyl)-2-prop-1-en-2-ylbutane-1,3-diol.
What is the SMILES notation for (2R,3R)-3-(6-methoxy-3-pyridinyl)-2-prop-1-en-2-ylbutane-1,3-diol?
The canonical SMILES for (2R,3R)-3-(6-methoxy-3-pyridinyl)-2-prop-1-en-2-ylbutane-1,3-diol is C=C(C)[C@H](CO)[C@@](C)(O)c1ccc(OC)nc1.
What is the InChIKey of (2R,3R)-3-(6-methoxy-3-pyridinyl)-2-prop-1-en-2-ylbutane-1,3-diol?
The InChIKey is BPCLIMIUGBFFOH-AAEUAGOBSA-N. The full InChI is InChI=1S/C13H19NO3/c1-9(2)11(8-15)13(3,16)10-5-6-12(17-4)14-7-10/h5-7,11,15-16H,1,8H2,2-4H3/t11-,13-/m0/s1.
What are the key properties of (2R,3R)-3-(6-methoxy-3-pyridinyl)-2-prop-1-en-2-ylbutane-1,3-diol?
(2R,3R)-3-(6-methoxy-3-pyridinyl)-2-prop-1-en-2-ylbutane-1,3-diol has a molecular weight of 237.30 g/mol, XLogP of 1.48, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3R)-3-(6-methoxy-3-pyridinyl)-2-prop-1-en-2-ylbutane-1,3-diol is sourced from PubChem (CID 146167568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).