About [(2S)-2-(3,3,3-trifluoropropylsulfonyl)but-3-en-2-yl]benzene
[(2S)-2-(3,3,3-trifluoropropylsulfonyl)but-3-en-2-yl]benzene (PubChem CID 146167607) has the molecular formula C13H15F3O2S
and a molecular weight of 292.32 g/mol. Its IUPAC name is [(2S)-2-(3,3,3-trifluoropropylsulfonyl)but-3-en-2-yl]benzene.
Molecular Properties
| Compound Name | [(2S)-2-(3,3,3-trifluoropropylsulfonyl)but-3-en-2-yl]benzene |
| PubChem CID | 146167607 |
| Molecular Formula | C13H15F3O2S |
| Molecular Weight | 292.32 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | [(2S)-2-(3,3,3-trifluoropropylsulfonyl)but-3-en-2-yl]benzene |
| SMILES | C=C[C@@](C)(c1ccccc1)S(=O)(=O)CCC(F)(F)F |
| InChI | InChI=1S/C13H15F3O2S/c1-3-12(2,11-7-5-4-6-8-11)19(17,18)10-9-13(14,15)16/h3-8H,1,9-10H2,2H3/t12-/m0/s1 |
| InChIKey | GJVVVBFPBCMGSS-LBPRGKRZSA-N |
| XLogP | 3.45 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.32 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(2S)-2-(3,3,3-trifluoropropylsulfonyl)but-3-en-2-yl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-2-(3,3,3-trifluoropropylsulfonyl)but-3-en-2-yl]benzene?
The IUPAC name of [(2S)-2-(3,3,3-trifluoropropylsulfonyl)but-3-en-2-yl]benzene (CID 146167607) is [(2S)-2-(3,3,3-trifluoropropylsulfonyl)but-3-en-2-yl]benzene.
What is the SMILES notation for [(2S)-2-(3,3,3-trifluoropropylsulfonyl)but-3-en-2-yl]benzene?
The canonical SMILES for [(2S)-2-(3,3,3-trifluoropropylsulfonyl)but-3-en-2-yl]benzene is C=C[C@@](C)(c1ccccc1)S(=O)(=O)CCC(F)(F)F.
What is the InChIKey of [(2S)-2-(3,3,3-trifluoropropylsulfonyl)but-3-en-2-yl]benzene?
The InChIKey is GJVVVBFPBCMGSS-LBPRGKRZSA-N. The full InChI is InChI=1S/C13H15F3O2S/c1-3-12(2,11-7-5-4-6-8-11)19(17,18)10-9-13(14,15)16/h3-8H,1,9-10H2,2H3/t12-/m0/s1.
What are the key properties of [(2S)-2-(3,3,3-trifluoropropylsulfonyl)but-3-en-2-yl]benzene?
[(2S)-2-(3,3,3-trifluoropropylsulfonyl)but-3-en-2-yl]benzene has a molecular weight of 292.32 g/mol, XLogP of 3.45, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-2-(3,3,3-trifluoropropylsulfonyl)but-3-en-2-yl]benzene is sourced from PubChem (CID 146167607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).