C16H18N2O4 — CID 146167899
(3S,6S)-3,6-bis(furan-2-ylmethyl)-1,4-dimethylpiperazine-2,5-dione (PubChem CID 146167899) has the molecular formula C16H18N2O4 and a molecular weight of 302.33 g/mol. Its IUPAC name is (3S,6S)-3,6-bis(furan-2-ylmethyl)-1,4-dimethylpiperazine-2,5-dione.
| Compound Name | (3S,6S)-3,6-bis(furan-2-ylmethyl)-1,4-dimethylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 146167899 |
| Molecular Formula | C16H18N2O4 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | (3S,6S)-3,6-bis(furan-2-ylmethyl)-1,4-dimethylpiperazine-2,5-dione |
| SMILES | CN1C(=O)[C@H](Cc2ccco2)N(C)C(=O)[C@@H]1Cc1ccco1 |
| InChI | InChI=1S/C16H18N2O4/c1-17-13(9-11-5-3-7-21-11)16(20)18(2)14(15(17)19)10-12-6-4-8-22-12/h3-8,13-14H,9-10H2,1-2H3/t13-,14-/m0/s1 |
| InChIKey | LUANDLXNZRCJLC-KBPBESRZSA-N |
| XLogP | 1.33 |
| TPSA | 66.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |