About (3R)-3-anilino-4,4,4-trifluorobutan-1-ol
(3R)-3-anilino-4,4,4-trifluorobutan-1-ol (PubChem CID 146167923) has the molecular formula C10H12F3NO
and a molecular weight of 219.21 g/mol. Its IUPAC name is (3R)-3-anilino-4,4,4-trifluorobutan-1-ol.
Molecular Properties
| Compound Name | (3R)-3-anilino-4,4,4-trifluorobutan-1-ol |
| PubChem CID | 146167923 |
| Molecular Formula | C10H12F3NO |
| Molecular Weight | 219.21 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | (3R)-3-anilino-4,4,4-trifluorobutan-1-ol |
| SMILES | OCC[C@@H](Nc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C10H12F3NO/c11-10(12,13)9(6-7-15)14-8-4-2-1-3-5-8/h1-5,9,14-15H,6-7H2/t9-/m1/s1 |
| InChIKey | KUPBHGBVWCYDQO-SECBINFHSA-N |
| XLogP | 2.41 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.21 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3R)-3-anilino-4,4,4-trifluorobutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-anilino-4,4,4-trifluorobutan-1-ol?
The IUPAC name of (3R)-3-anilino-4,4,4-trifluorobutan-1-ol (CID 146167923) is (3R)-3-anilino-4,4,4-trifluorobutan-1-ol.
What is the SMILES notation for (3R)-3-anilino-4,4,4-trifluorobutan-1-ol?
The canonical SMILES for (3R)-3-anilino-4,4,4-trifluorobutan-1-ol is OCC[C@@H](Nc1ccccc1)C(F)(F)F.
What is the InChIKey of (3R)-3-anilino-4,4,4-trifluorobutan-1-ol?
The InChIKey is KUPBHGBVWCYDQO-SECBINFHSA-N. The full InChI is InChI=1S/C10H12F3NO/c11-10(12,13)9(6-7-15)14-8-4-2-1-3-5-8/h1-5,9,14-15H,6-7H2/t9-/m1/s1.
What are the key properties of (3R)-3-anilino-4,4,4-trifluorobutan-1-ol?
(3R)-3-anilino-4,4,4-trifluorobutan-1-ol has a molecular weight of 219.21 g/mol, XLogP of 2.41, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-anilino-4,4,4-trifluorobutan-1-ol is sourced from PubChem (CID 146167923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).