C25H27NO3 — CID 146168109
ethyl (Z)-2-benzyl-3-[(2R)-1-benzyl-6-oxo-2,3-dihydropyridin-2-yl]but-2-enoate (PubChem CID 146168109) has the molecular formula C25H27NO3 and a molecular weight of 389.50 g/mol. Its IUPAC name is ethyl (Z)-2-benzyl-3-[(2R)-1-benzyl-6-oxo-2,3-dihydropyridin-2-yl]but-2-enoate.
| Compound Name | ethyl (Z)-2-benzyl-3-[(2R)-1-benzyl-6-oxo-2,3-dihydropyridin-2-yl]but-2-enoate |
|---|---|
| PubChem CID | 146168109 |
| Molecular Formula | C25H27NO3 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | ethyl (Z)-2-benzyl-3-[(2R)-1-benzyl-6-oxo-2,3-dihydropyridin-2-yl]but-2-enoate |
| SMILES | CCOC(=O)/C(Cc1ccccc1)=C(/C)[C@H]1CC=CC(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C25H27NO3/c1-3-29-25(28)22(17-20-11-6-4-7-12-20)19(2)23-15-10-16-24(27)26(23)18-21-13-8-5-9-14-21/h4-14,16,23H,3,15,17-18H2,1-2H3/b22-19-/t23-/m1/s1 |
| InChIKey | BLDQPUNUTJHHKS-AQZJAAOESA-N |
| XLogP | 4.47 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|