C20H35NO3 — CID 146168148
(E,2R,3R,7R,8Z)-8-[(1S,9aS)-1-hydroxy-1-methyl-4,6,7,8,9,9a-hexahydro-2H-quinolizin-3-ylidene]-4,7-dimethyloct-4-ene-2,3-diol (PubChem CID 146168148) has the molecular formula C20H35NO3 and a molecular weight of 337.50 g/mol. Its IUPAC name is (E,2R,3R,7R,8Z)-8-[(1S,9aS)-1-hydroxy-1-methyl-4,6,7,8,9,9a-hexahydro-2H-quinolizin-3-ylidene]-4,7-dimethyloct-4-ene-2,3-diol.
| Compound Name | (E,2R,3R,7R,8Z)-8-[(1S,9aS)-1-hydroxy-1-methyl-4,6,7,8,9,9a-hexahydro-2H-quinolizin-3-ylidene]-4,7-dimethyloct-4-ene-2,3-diol |
|---|---|
| PubChem CID | 146168148 |
| Molecular Formula | C20H35NO3 |
| Molecular Weight | 337.50 g/mol |
| Exact Mass | 337.26 |
| IUPAC Name | (E,2R,3R,7R,8Z)-8-[(1S,9aS)-1-hydroxy-1-methyl-4,6,7,8,9,9a-hexahydro-2H-quinolizin-3-ylidene]-4,7-dimethyloct-4-ene-2,3-diol |
| SMILES | C/C(=C\C[C@@H](C)/C=C1\CN2CCCC[C@H]2[C@@](C)(O)C1)[C@@H](O)[C@@H](C)O |
| InChI | InChI=1S/C20H35NO3/c1-14(8-9-15(2)19(23)16(3)22)11-17-12-20(4,24)18-7-5-6-10-21(18)13-17/h9,11,14,16,18-19,22-24H,5-8,10,12-13H2,1-4H3/b15-9+,17-11-/t14-,16-,18+,19-,20+/m1/s1 |
| InChIKey | AHOCFQLZGPIQPR-GDNNOGKFSA-N |
| XLogP | 2.64 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.50 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|