C30H21N2O4PS2 — CID 146168249
2-[6-(2-diphenylphosphanylbenzoyl)oxy-1,3-benzothiazol-2-yl]-4,5-dihydro-1,3-thiazole-4-carboxylic acid (PubChem CID 146168249) has the molecular formula C30H21N2O4PS2 and a molecular weight of 568.62 g/mol. Its IUPAC name is 2-[6-(2-diphenylphosphanylbenzoyl)oxy-1,3-benzothiazol-2-yl]-4,5-dihydro-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[6-(2-diphenylphosphanylbenzoyl)oxy-1,3-benzothiazol-2-yl]-4,5-dihydro-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 146168249 |
| Molecular Formula | C30H21N2O4PS2 |
| Molecular Weight | 568.62 g/mol |
| Exact Mass | 568.07 |
| IUPAC Name | 2-[6-(2-diphenylphosphanylbenzoyl)oxy-1,3-benzothiazol-2-yl]-4,5-dihydro-1,3-thiazole-4-carboxylic acid |
| SMILES | O=C(Oc1ccc2nc(C3=NC(C(=O)O)CS3)sc2c1)c1ccccc1P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H21N2O4PS2/c33-29(34)24-18-38-27(32-24)28-31-23-16-15-19(17-26(23)39-28)36-30(35)22-13-7-8-14-25(22)37(20-9-3-1-4-10-20)21-11-5-2-6-12-21/h1-17,24H,18H2,(H,33,34) |
| InChIKey | QJXHRERNVCZYJL-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.62 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|