C18H18F3N3O — CID 146168290
(3Z)-1,1,1-trifluoro-3-[4-(1-phenylpyrrol-3-yl)-1,4-diazepan-2-ylidene]propan-2-one (PubChem CID 146168290) has the molecular formula C18H18F3N3O and a molecular weight of 349.36 g/mol. Its IUPAC name is (3Z)-1,1,1-trifluoro-3-[4-(1-phenylpyrrol-3-yl)-1,4-diazepan-2-ylidene]propan-2-one.
| Compound Name | (3Z)-1,1,1-trifluoro-3-[4-(1-phenylpyrrol-3-yl)-1,4-diazepan-2-ylidene]propan-2-one |
|---|---|
| PubChem CID | 146168290 |
| Molecular Formula | C18H18F3N3O |
| Molecular Weight | 349.36 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | (3Z)-1,1,1-trifluoro-3-[4-(1-phenylpyrrol-3-yl)-1,4-diazepan-2-ylidene]propan-2-one |
| SMILES | O=C(/C=C1/CN(c2ccn(-c3ccccc3)c2)CCCN1)C(F)(F)F |
| InChI | InChI=1S/C18H18F3N3O/c19-18(20,21)17(25)11-14-12-23(9-4-8-22-14)16-7-10-24(13-16)15-5-2-1-3-6-15/h1-3,5-7,10-11,13,22H,4,8-9,12H2/b14-11- |
| InChIKey | IBOQPCPZPOGBSP-KAMYIIQDSA-N |
| XLogP | 3.29 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.36 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|