C26H42O10 — CID 146168300
[(2R,3R,4S,5R)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-oxooxan-2-yl]methyl 2,2-dimethylpropanoate (PubChem CID 146168300) has the molecular formula C26H42O10 and a molecular weight of 514.61 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-oxooxan-2-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(2R,3R,4S,5R)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-oxooxan-2-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 146168300 |
| Molecular Formula | C26H42O10 |
| Molecular Weight | 514.61 g/mol |
| Exact Mass | 514.28 |
| IUPAC Name | [(2R,3R,4S,5R)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-oxooxan-2-yl]methyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OC[C@H]1OC(=O)[C@H](OC(=O)C(C)(C)C)[C@@H](OC(=O)C(C)(C)C)[C@@H]1OC(=O)C(C)(C)C |
| InChI | InChI=1S/C26H42O10/c1-23(2,3)19(28)32-13-14-15(34-20(29)24(4,5)6)16(35-21(30)25(7,8)9)17(18(27)33-14)36-22(31)26(10,11)12/h14-17H,13H2,1-12H3/t14-,15-,16+,17-/m1/s1 |
| InChIKey | KQSNDXDKHNSDHK-WCXIOVBPSA-N |
| XLogP | 3.37 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.61 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|