C21H16N2O6S — CID 146168382
ethyl (E)-5-[(4-nitrophenyl)sulfonyl-(2-phenylethynyl)amino]pent-2-en-4-ynoate (PubChem CID 146168382) has the molecular formula C21H16N2O6S and a molecular weight of 424.43 g/mol. Its IUPAC name is ethyl (E)-5-[(4-nitrophenyl)sulfonyl-(2-phenylethynyl)amino]pent-2-en-4-ynoate.
| Compound Name | ethyl (E)-5-[(4-nitrophenyl)sulfonyl-(2-phenylethynyl)amino]pent-2-en-4-ynoate |
|---|---|
| PubChem CID | 146168382 |
| Molecular Formula | C21H16N2O6S |
| Molecular Weight | 424.43 g/mol |
| Exact Mass | 424.07 |
| IUPAC Name | ethyl (E)-5-[(4-nitrophenyl)sulfonyl-(2-phenylethynyl)amino]pent-2-en-4-ynoate |
| SMILES | CCOC(=O)/C=C/C#CN(C#Cc1ccccc1)S(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H16N2O6S/c1-2-29-21(24)10-6-7-16-22(17-15-18-8-4-3-5-9-18)30(27,28)20-13-11-19(12-14-20)23(25)26/h3-6,8-14H,2H2,1H3/b10-6+ |
| InChIKey | QUPVTKRMDQSLGH-UXBLZVDNSA-N |
| XLogP | 2.67 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.43 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|