C19H16F2O2 — CID 146168497
1-(3,5-difluorophenyl)-3-[(1S,8R,9R)-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6-trien-9-yl]propan-1-one (PubChem CID 146168497) has the molecular formula C19H16F2O2 and a molecular weight of 314.33 g/mol. Its IUPAC name is 1-(3,5-difluorophenyl)-3-[(1S,8R,9R)-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6-trien-9-yl]propan-1-one.
| Compound Name | 1-(3,5-difluorophenyl)-3-[(1S,8R,9R)-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6-trien-9-yl]propan-1-one |
|---|---|
| PubChem CID | 146168497 |
| Molecular Formula | C19H16F2O2 |
| Molecular Weight | 314.33 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | 1-(3,5-difluorophenyl)-3-[(1S,8R,9R)-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6-trien-9-yl]propan-1-one |
| SMILES | O=C(CC[C@@H]1C[C@@H]2O[C@H]1c1ccccc12)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C19H16F2O2/c20-13-7-12(8-14(21)10-13)17(22)6-5-11-9-18-15-3-1-2-4-16(15)19(11)23-18/h1-4,7-8,10-11,18-19H,5-6,9H2/t11-,18+,19-/m1/s1 |
| InChIKey | RXMMHZOQTRVYOQ-RIPJAXHCSA-N |
| XLogP | 4.76 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.33 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |