C20H22O3 — CID 146168764
benzyl (Z,2R)-2-[(R)-hydroxy(phenyl)methyl]hex-3-enoate (PubChem CID 146168764) has the molecular formula C20H22O3 and a molecular weight of 310.39 g/mol. Its IUPAC name is benzyl (Z,2R)-2-[(R)-hydroxy(phenyl)methyl]hex-3-enoate.
| Compound Name | benzyl (Z,2R)-2-[(R)-hydroxy(phenyl)methyl]hex-3-enoate |
|---|---|
| PubChem CID | 146168764 |
| Molecular Formula | C20H22O3 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | benzyl (Z,2R)-2-[(R)-hydroxy(phenyl)methyl]hex-3-enoate |
| SMILES | CC/C=C\[C@@H](C(=O)OCc1ccccc1)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C20H22O3/c1-2-3-14-18(19(21)17-12-8-5-9-13-17)20(22)23-15-16-10-6-4-7-11-16/h3-14,18-19,21H,2,15H2,1H3/b14-3-/t18-,19+/m1/s1 |
| InChIKey | DNXHPWGYGZSRTL-JKDMTXTJSA-N |
| XLogP | 4.05 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|