C22H26O4 — CID 146168772
benzyl (2S,3R)-2-[(2S,3R)-3-butyloxiran-2-yl]-3-hydroxy-3-phenylpropanoate (PubChem CID 146168772) has the molecular formula C22H26O4 and a molecular weight of 354.45 g/mol. Its IUPAC name is benzyl (2S,3R)-2-[(2S,3R)-3-butyloxiran-2-yl]-3-hydroxy-3-phenylpropanoate.
| Compound Name | benzyl (2S,3R)-2-[(2S,3R)-3-butyloxiran-2-yl]-3-hydroxy-3-phenylpropanoate |
|---|---|
| PubChem CID | 146168772 |
| Molecular Formula | C22H26O4 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | benzyl (2S,3R)-2-[(2S,3R)-3-butyloxiran-2-yl]-3-hydroxy-3-phenylpropanoate |
| SMILES | CCCC[C@H]1O[C@H]1[C@@H](C(=O)OCc1ccccc1)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C22H26O4/c1-2-3-14-18-21(26-18)19(20(23)17-12-8-5-9-13-17)22(24)25-15-16-10-6-4-7-11-16/h4-13,18-21,23H,2-3,14-15H2,1H3/t18-,19+,20+,21-/m1/s1 |
| InChIKey | LDGNKFKEXYBRRY-IVAOSVALSA-N |
| XLogP | 4.04 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|