C17H33BO3 — CID 146168888
4,4,5,5-tetramethyl-2-[(1R)-1-(oxan-4-yl)hexyl]-1,3,2-dioxaborolane (PubChem CID 146168888) has the molecular formula C17H33BO3 and a molecular weight of 296.26 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[(1R)-1-(oxan-4-yl)hexyl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[(1R)-1-(oxan-4-yl)hexyl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 146168888 |
| Molecular Formula | C17H33BO3 |
| Molecular Weight | 296.26 g/mol |
| Exact Mass | 296.25 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[(1R)-1-(oxan-4-yl)hexyl]-1,3,2-dioxaborolane |
| SMILES | CCCCC[C@@H](B1OC(C)(C)C(C)(C)O1)C1CCOCC1 |
| InChI | InChI=1S/C17H33BO3/c1-6-7-8-9-15(14-10-12-19-13-11-14)18-20-16(2,3)17(4,5)21-18/h14-15H,6-13H2,1-5H3/t15-/m1/s1 |
| InChIKey | UKFGNHBIYXDXMN-OAHLLOKOSA-N |
| XLogP | 4.46 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.26 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|