C11H14F3N — CID 146168994
N,4-dimethyl-N-(3,3,3-trifluoropropyl)aniline (PubChem CID 146168994) has the molecular formula C11H14F3N and a molecular weight of 217.23 g/mol. Its IUPAC name is N,4-dimethyl-N-(3,3,3-trifluoropropyl)aniline.
| Compound Name | N,4-dimethyl-N-(3,3,3-trifluoropropyl)aniline |
|---|---|
| PubChem CID | 146168994 |
| Molecular Formula | C11H14F3N |
| Molecular Weight | 217.23 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | N,4-dimethyl-N-(3,3,3-trifluoropropyl)aniline |
| SMILES | Cc1ccc(N(C)CCC(F)(F)F)cc1 |
| InChI | InChI=1S/C11H14F3N/c1-9-3-5-10(6-4-9)15(2)8-7-11(12,13)14/h3-6H,7-8H2,1-2H3 |
| InChIKey | YCKYXLHRJVFMDC-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.23 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|