C22H28BNO2 — CID 146169205
1-[(S)-phenyl-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]azetidine (PubChem CID 146169205) has the molecular formula C22H28BNO2 and a molecular weight of 349.28 g/mol. Its IUPAC name is 1-[(S)-phenyl-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]azetidine.
| Compound Name | 1-[(S)-phenyl-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]azetidine |
|---|---|
| PubChem CID | 146169205 |
| Molecular Formula | C22H28BNO2 |
| Molecular Weight | 349.28 g/mol |
| Exact Mass | 349.22 |
| IUPAC Name | 1-[(S)-phenyl-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]azetidine |
| SMILES | CC1(C)OB(c2ccccc2[C@H](c2ccccc2)N2CCC2)OC1(C)C |
| InChI | InChI=1S/C22H28BNO2/c1-21(2)22(3,4)26-23(25-21)19-14-9-8-13-18(19)20(24-15-10-16-24)17-11-6-5-7-12-17/h5-9,11-14,20H,10,15-16H2,1-4H3/t20-/m0/s1 |
| InChIKey | AWFSOIRYYRSAII-FQEVSTJZSA-N |
| XLogP | 3.78 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.28 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|