About ethyl 4-(dichloro-λ3-iodanyl)benzoate
ethyl 4-(dichloro-λ3-iodanyl)benzoate (PubChem CID 146169313) has the molecular formula C9H9Cl2IO2
and a molecular weight of 346.98 g/mol. Its IUPAC name is ethyl 4-(dichloro-λ3-iodanyl)benzoate.
Molecular Properties
| Compound Name | ethyl 4-(dichloro-λ3-iodanyl)benzoate |
| PubChem CID | 146169313 |
| Molecular Formula | C9H9Cl2IO2 |
| Molecular Weight | 346.98 g/mol |
| Exact Mass | 345.90 |
| IUPAC Name | ethyl 4-(dichloro-λ3-iodanyl)benzoate |
| SMILES | CCOC(=O)c1ccc(I(Cl)Cl)cc1 |
| InChI | InChI=1S/C9H9Cl2IO2/c1-2-14-9(13)7-3-5-8(6-4-7)12(10)11/h3-6H,2H2,1H3 |
| InChIKey | IYBOUVIAMHRIGP-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.98 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-(dichloro-λ3-iodanyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-(dichloro-λ3-iodanyl)benzoate?
The IUPAC name of ethyl 4-(dichloro-λ3-iodanyl)benzoate (CID 146169313) is ethyl 4-(dichloro-λ3-iodanyl)benzoate.
What is the SMILES notation for ethyl 4-(dichloro-λ3-iodanyl)benzoate?
The canonical SMILES for ethyl 4-(dichloro-λ3-iodanyl)benzoate is CCOC(=O)c1ccc(I(Cl)Cl)cc1.
What is the InChIKey of ethyl 4-(dichloro-λ3-iodanyl)benzoate?
The InChIKey is IYBOUVIAMHRIGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9Cl2IO2/c1-2-14-9(13)7-3-5-8(6-4-7)12(10)11/h3-6H,2H2,1H3.
What are the key properties of ethyl 4-(dichloro-λ3-iodanyl)benzoate?
ethyl 4-(dichloro-λ3-iodanyl)benzoate has a molecular weight of 346.98 g/mol, XLogP of 3.85, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-(dichloro-λ3-iodanyl)benzoate is sourced from PubChem (CID 146169313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).