C26H43NOSi — CID 146169535
(3S,8S,9S,10R,13S,14S,17S)-3-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-17-carbonitrile (PubChem CID 146169535) has the molecular formula C26H43NOSi and a molecular weight of 413.72 g/mol. Its IUPAC name is (3S,8S,9S,10R,13S,14S,17S)-3-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-17-carbonitrile.
| Compound Name | (3S,8S,9S,10R,13S,14S,17S)-3-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-17-carbonitrile |
|---|---|
| PubChem CID | 146169535 |
| Molecular Formula | C26H43NOSi |
| Molecular Weight | 413.72 g/mol |
| Exact Mass | 413.31 |
| IUPAC Name | (3S,8S,9S,10R,13S,14S,17S)-3-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-17-carbonitrile |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CC[C@@]2(C)C(=CC[C@H]3[C@@H]4CC[C@H](C#N)[C@@]4(C)CC[C@@H]32)C1 |
| InChI | InChI=1S/C26H43NOSi/c1-24(2,3)29(6,7)28-20-12-14-25(4)18(16-20)8-10-21-22-11-9-19(17-27)26(22,5)15-13-23(21)25/h8,19-23H,9-16H2,1-7H3/t19-,20+,21+,22+,23+,25+,26-/m1/s1 |
| InChIKey | DBJZIEVVYJDWBN-YZZOFKFNSA-N |
| XLogP | 7.48 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.72 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|