C19H20FNO2 — CID 146169611
methyl 2-(4-fluorophenyl)-2-(N-methylanilino)pent-4-enoate (PubChem CID 146169611) has the molecular formula C19H20FNO2 and a molecular weight of 313.37 g/mol. Its IUPAC name is methyl 2-(4-fluorophenyl)-2-(N-methylanilino)pent-4-enoate.
| Compound Name | methyl 2-(4-fluorophenyl)-2-(N-methylanilino)pent-4-enoate |
|---|---|
| PubChem CID | 146169611 |
| Molecular Formula | C19H20FNO2 |
| Molecular Weight | 313.37 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | methyl 2-(4-fluorophenyl)-2-(N-methylanilino)pent-4-enoate |
| SMILES | C=CCC(C(=O)OC)(c1ccc(F)cc1)N(C)c1ccccc1 |
| InChI | InChI=1S/C19H20FNO2/c1-4-14-19(18(22)23-3,15-10-12-16(20)13-11-15)21(2)17-8-6-5-7-9-17/h4-13H,1,14H2,2-3H3 |
| InChIKey | PCUYCBHUHZBJPW-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.37 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|