C15H15FN2O2S — CID 146169783
1-[2-(4-(18F)fluoro-2-nitrophenyl)sulfanylphenyl]-N,N-dimethylmethanamine (PubChem CID 146169783) has the molecular formula C15H15FN2O2S and a molecular weight of 305.36 g/mol. Its IUPAC name is 1-[2-(4-(18F)fluoro-2-nitrophenyl)sulfanylphenyl]-N,N-dimethylmethanamine.
| Compound Name | 1-[2-(4-(18F)fluoro-2-nitrophenyl)sulfanylphenyl]-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 146169783 |
| Molecular Formula | C15H15FN2O2S |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | 1-[2-(4-(18F)fluoro-2-nitrophenyl)sulfanylphenyl]-N,N-dimethylmethanamine |
| SMILES | CN(C)Cc1ccccc1Sc1ccc([18F])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H15FN2O2S/c1-17(2)10-11-5-3-4-6-14(11)21-15-8-7-12(16)9-13(15)18(19)20/h3-9H,10H2,1-2H3/i16-1 |
| InChIKey | GVMFPCZEWOOFAQ-GKTGUEEDSA-N |
| XLogP | 3.95 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|