C28H36O13S — CID 146170006
[(3S,6S)-4,5-diacetyloxy-6-[(2S,5S)-4,5-diacetyloxy-6-methyl-2-phenylsulfanyloxan-3-yl]oxy-2-methyloxan-3-yl] acetate (PubChem CID 146170006) has the molecular formula C28H36O13S and a molecular weight of 612.65 g/mol. Its IUPAC name is [(3S,6S)-4,5-diacetyloxy-6-[(2S,5S)-4,5-diacetyloxy-6-methyl-2-phenylsulfanyloxan-3-yl]oxy-2-methyloxan-3-yl] acetate.
| Compound Name | [(3S,6S)-4,5-diacetyloxy-6-[(2S,5S)-4,5-diacetyloxy-6-methyl-2-phenylsulfanyloxan-3-yl]oxy-2-methyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 146170006 |
| Molecular Formula | C28H36O13S |
| Molecular Weight | 612.65 g/mol |
| Exact Mass | 612.19 |
| IUPAC Name | [(3S,6S)-4,5-diacetyloxy-6-[(2S,5S)-4,5-diacetyloxy-6-methyl-2-phenylsulfanyloxan-3-yl]oxy-2-methyloxan-3-yl] acetate |
| SMILES | CC(=O)OC1C(OC(C)=O)[C@@H](OC(C)=O)C(C)O[C@H]1OC1C(OC(C)=O)[C@@H](OC(C)=O)C(C)O[C@H]1Sc1ccccc1 |
| InChI | InChI=1S/C28H36O13S/c1-13-21(36-15(3)29)23(38-17(5)31)25(40-19(7)33)27(34-13)41-26-24(39-18(6)32)22(37-16(4)30)14(2)35-28(26)42-20-11-9-8-10-12-20/h8-14,21-28H,1-7H3/t13?,14?,21-,22-,23?,24?,25?,26?,27-,28-/m0/s1 |
| InChIKey | WTUZWIBAXCKJFW-QZVAACINSA-N |
| XLogP | 2.31 |
| TPSA | 159.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.65 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|