C18H26O6S — CID 146170076
(4aS,7S)-2,3-dimethoxy-2,3,5-trimethyl-7-phenylsulfanyl-5,7,8,8a-tetrahydro-4aH-pyrano[3,4-b][1,4]dioxin-8-ol (PubChem CID 146170076) has the molecular formula C18H26O6S and a molecular weight of 370.47 g/mol. Its IUPAC name is (4aS,7S)-2,3-dimethoxy-2,3,5-trimethyl-7-phenylsulfanyl-5,7,8,8a-tetrahydro-4aH-pyrano[3,4-b][1,4]dioxin-8-ol.
| Compound Name | (4aS,7S)-2,3-dimethoxy-2,3,5-trimethyl-7-phenylsulfanyl-5,7,8,8a-tetrahydro-4aH-pyrano[3,4-b][1,4]dioxin-8-ol |
|---|---|
| PubChem CID | 146170076 |
| Molecular Formula | C18H26O6S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | (4aS,7S)-2,3-dimethoxy-2,3,5-trimethyl-7-phenylsulfanyl-5,7,8,8a-tetrahydro-4aH-pyrano[3,4-b][1,4]dioxin-8-ol |
| SMILES | COC1(C)OC2C(O)[C@H](Sc3ccccc3)OC(C)[C@@H]2OC1(C)OC |
| InChI | InChI=1S/C18H26O6S/c1-11-14-15(24-18(3,21-5)17(2,20-4)23-14)13(19)16(22-11)25-12-9-7-6-8-10-12/h6-11,13-16,19H,1-5H3/t11?,13?,14-,15?,16-,17?,18?/m0/s1 |
| InChIKey | JHXHAILUWYHROB-QOSKYOKOSA-N |
| XLogP | 2.39 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |