About difluoromethyl-phenyl-(2,4,6-trimethoxyphenyl)sulfanium
difluoromethyl-phenyl-(2,4,6-trimethoxyphenyl)sulfanium (PubChem CID 146170229) has the molecular formula C16H17F2O3S+
and a molecular weight of 327.37 g/mol. Its IUPAC name is difluoromethyl-phenyl-(2,4,6-trimethoxyphenyl)sulfanium.
Molecular Properties
| Compound Name | difluoromethyl-phenyl-(2,4,6-trimethoxyphenyl)sulfanium |
| PubChem CID | 146170229 |
| Molecular Formula | C16H17F2O3S+ |
| Molecular Weight | 327.37 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | difluoromethyl-phenyl-(2,4,6-trimethoxyphenyl)sulfanium |
| SMILES | COc1cc(OC)c([S+](c2ccccc2)C(F)F)c(OC)c1 |
| InChI | InChI=1S/C16H17F2O3S/c1-19-11-9-13(20-2)15(14(10-11)21-3)22(16(17)18)12-7-5-4-6-8-12/h4-10,16H,1-3H3/q+1 |
| InChIKey | CQURDHIWFSDFEI-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.37 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze difluoromethyl-phenyl-(2,4,6-trimethoxyphenyl)sulfanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of difluoromethyl-phenyl-(2,4,6-trimethoxyphenyl)sulfanium?
The IUPAC name of difluoromethyl-phenyl-(2,4,6-trimethoxyphenyl)sulfanium (CID 146170229) is difluoromethyl-phenyl-(2,4,6-trimethoxyphenyl)sulfanium.
What is the SMILES notation for difluoromethyl-phenyl-(2,4,6-trimethoxyphenyl)sulfanium?
The canonical SMILES for difluoromethyl-phenyl-(2,4,6-trimethoxyphenyl)sulfanium is COc1cc(OC)c([S+](c2ccccc2)C(F)F)c(OC)c1.
What is the InChIKey of difluoromethyl-phenyl-(2,4,6-trimethoxyphenyl)sulfanium?
The InChIKey is CQURDHIWFSDFEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17F2O3S/c1-19-11-9-13(20-2)15(14(10-11)21-3)22(16(17)18)12-7-5-4-6-8-12/h4-10,16H,1-3H3/q+1.
What are the key properties of difluoromethyl-phenyl-(2,4,6-trimethoxyphenyl)sulfanium?
difluoromethyl-phenyl-(2,4,6-trimethoxyphenyl)sulfanium has a molecular weight of 327.37 g/mol, XLogP of 3.97, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for difluoromethyl-phenyl-(2,4,6-trimethoxyphenyl)sulfanium is sourced from PubChem (CID 146170229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).