C14H24O5Si — CID 146170276
methyl (1S,2R,3S,6S)-2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-7-oxabicyclo[4.1.0]hept-4-ene-3-carboxylate (PubChem CID 146170276) has the molecular formula C14H24O5Si and a molecular weight of 300.43 g/mol. Its IUPAC name is methyl (1S,2R,3S,6S)-2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-7-oxabicyclo[4.1.0]hept-4-ene-3-carboxylate.
| Compound Name | methyl (1S,2R,3S,6S)-2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-7-oxabicyclo[4.1.0]hept-4-ene-3-carboxylate |
|---|---|
| PubChem CID | 146170276 |
| Molecular Formula | C14H24O5Si |
| Molecular Weight | 300.43 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | methyl (1S,2R,3S,6S)-2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-7-oxabicyclo[4.1.0]hept-4-ene-3-carboxylate |
| SMILES | COC(=O)[C@]1(O)C=C[C@@H]2O[C@@H]2[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H24O5Si/c1-13(2,3)20(5,6)19-11-10-9(18-10)7-8-14(11,16)12(15)17-4/h7-11,16H,1-6H3/t9-,10-,11+,14-/m0/s1 |
| InChIKey | GWRJDHBYGRBPCT-DYNIEEOBSA-N |
| XLogP | 1.62 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.43 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|