About 1-[(2-bromophenyl)-(3,5-ditert-butyl-4-hydroxyphenyl)methyl]pyrrolidin-2-one
1-[(2-bromophenyl)-(3,5-ditert-butyl-4-hydroxyphenyl)methyl]pyrrolidin-2-one (PubChem CID 146170305) has the molecular formula C25H32BrNO2
and a molecular weight of 458.44 g/mol. Its IUPAC name is 1-[(2-bromophenyl)-(3,5-ditert-butyl-4-hydroxyphenyl)methyl]pyrrolidin-2-one.
Molecular Properties
| Compound Name | 1-[(2-bromophenyl)-(3,5-ditert-butyl-4-hydroxyphenyl)methyl]pyrrolidin-2-one |
| PubChem CID | 146170305 |
| Molecular Formula | C25H32BrNO2 |
| Molecular Weight | 458.44 g/mol |
| Exact Mass | 457.16 |
| IUPAC Name | 1-[(2-bromophenyl)-(3,5-ditert-butyl-4-hydroxyphenyl)methyl]pyrrolidin-2-one |
| SMILES | CC(C)(C)c1cc(C(c2ccccc2Br)N2CCCC2=O)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C25H32BrNO2/c1-24(2,3)18-14-16(15-19(23(18)29)25(4,5)6)22(27-13-9-12-21(27)28)17-10-7-8-11-20(17)26/h7-8,10-11,14-15,22,29H,9,12-13H2,1-6H3 |
| InChIKey | CCRRZALOYPNUJN-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 458.44 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(2-bromophenyl)-(3,5-ditert-butyl-4-hydroxyphenyl)methyl]pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2-bromophenyl)-(3,5-ditert-butyl-4-hydroxyphenyl)methyl]pyrrolidin-2-one?
The IUPAC name of 1-[(2-bromophenyl)-(3,5-ditert-butyl-4-hydroxyphenyl)methyl]pyrrolidin-2-one (CID 146170305) is 1-[(2-bromophenyl)-(3,5-ditert-butyl-4-hydroxyphenyl)methyl]pyrrolidin-2-one.
What is the SMILES notation for 1-[(2-bromophenyl)-(3,5-ditert-butyl-4-hydroxyphenyl)methyl]pyrrolidin-2-one?
The canonical SMILES for 1-[(2-bromophenyl)-(3,5-ditert-butyl-4-hydroxyphenyl)methyl]pyrrolidin-2-one is CC(C)(C)c1cc(C(c2ccccc2Br)N2CCCC2=O)cc(C(C)(C)C)c1O.
What is the InChIKey of 1-[(2-bromophenyl)-(3,5-ditert-butyl-4-hydroxyphenyl)methyl]pyrrolidin-2-one?
The InChIKey is CCRRZALOYPNUJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H32BrNO2/c1-24(2,3)18-14-16(15-19(23(18)29)25(4,5)6)22(27-13-9-12-21(27)28)17-10-7-8-11-20(17)26/h7-8,10-11,14-15,22,29H,9,12-13H2,1-6H3.
What are the key properties of 1-[(2-bromophenyl)-(3,5-ditert-butyl-4-hydroxyphenyl)methyl]pyrrolidin-2-one?
1-[(2-bromophenyl)-(3,5-ditert-butyl-4-hydroxyphenyl)methyl]pyrrolidin-2-one has a molecular weight of 458.44 g/mol, XLogP of 6.46, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2-bromophenyl)-(3,5-ditert-butyl-4-hydroxyphenyl)methyl]pyrrolidin-2-one is sourced from PubChem (CID 146170305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).