About 6,6-dimethyl-5,7-dihydro-2,1-benzoxazol-4-one
6,6-dimethyl-5,7-dihydro-2,1-benzoxazol-4-one (PubChem CID 146170598) has the molecular formula C9H11NO2
and a molecular weight of 165.19 g/mol. Its IUPAC name is 6,6-dimethyl-5,7-dihydro-2,1-benzoxazol-4-one.
Molecular Properties
| Compound Name | 6,6-dimethyl-5,7-dihydro-2,1-benzoxazol-4-one |
| PubChem CID | 146170598 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | 6,6-dimethyl-5,7-dihydro-2,1-benzoxazol-4-one |
| SMILES | CC1(C)CC(=O)c2conc2C1 |
| InChI | InChI=1S/C9H11NO2/c1-9(2)3-7-6(5-12-10-7)8(11)4-9/h5H,3-4H2,1-2H3 |
| InChIKey | YQHIGOYPNBOESC-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6,6-dimethyl-5,7-dihydro-2,1-benzoxazol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,6-dimethyl-5,7-dihydro-2,1-benzoxazol-4-one?
The IUPAC name of 6,6-dimethyl-5,7-dihydro-2,1-benzoxazol-4-one (CID 146170598) is 6,6-dimethyl-5,7-dihydro-2,1-benzoxazol-4-one.
What is the SMILES notation for 6,6-dimethyl-5,7-dihydro-2,1-benzoxazol-4-one?
The canonical SMILES for 6,6-dimethyl-5,7-dihydro-2,1-benzoxazol-4-one is CC1(C)CC(=O)c2conc2C1.
What is the InChIKey of 6,6-dimethyl-5,7-dihydro-2,1-benzoxazol-4-one?
The InChIKey is YQHIGOYPNBOESC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO2/c1-9(2)3-7-6(5-12-10-7)8(11)4-9/h5H,3-4H2,1-2H3.
What are the key properties of 6,6-dimethyl-5,7-dihydro-2,1-benzoxazol-4-one?
6,6-dimethyl-5,7-dihydro-2,1-benzoxazol-4-one has a molecular weight of 165.19 g/mol, XLogP of 1.83, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,6-dimethyl-5,7-dihydro-2,1-benzoxazol-4-one is sourced from PubChem (CID 146170598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).