About N'-(2,6-dimethylphenyl)-N'-(pyrazol-1-ylmethyl)oxamide
N'-(2,6-dimethylphenyl)-N'-(pyrazol-1-ylmethyl)oxamide (PubChem CID 146170629) has the molecular formula C14H16N4O2
and a molecular weight of 272.31 g/mol. Its IUPAC name is N'-(2,6-dimethylphenyl)-N'-(pyrazol-1-ylmethyl)oxamide.
Molecular Properties
| Compound Name | N'-(2,6-dimethylphenyl)-N'-(pyrazol-1-ylmethyl)oxamide |
| PubChem CID | 146170629 |
| Molecular Formula | C14H16N4O2 |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | N'-(2,6-dimethylphenyl)-N'-(pyrazol-1-ylmethyl)oxamide |
| SMILES | Cc1cccc(C)c1N(Cn1cccn1)C(=O)C(N)=O |
| InChI | InChI=1S/C14H16N4O2/c1-10-5-3-6-11(2)12(10)18(14(20)13(15)19)9-17-8-4-7-16-17/h3-8H,9H2,1-2H3,(H2,15,19) |
| InChIKey | KKGLWAGKUHWHHE-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N'-(2,6-dimethylphenyl)-N'-(pyrazol-1-ylmethyl)oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(2,6-dimethylphenyl)-N'-(pyrazol-1-ylmethyl)oxamide?
The IUPAC name of N'-(2,6-dimethylphenyl)-N'-(pyrazol-1-ylmethyl)oxamide (CID 146170629) is N'-(2,6-dimethylphenyl)-N'-(pyrazol-1-ylmethyl)oxamide.
What is the SMILES notation for N'-(2,6-dimethylphenyl)-N'-(pyrazol-1-ylmethyl)oxamide?
The canonical SMILES for N'-(2,6-dimethylphenyl)-N'-(pyrazol-1-ylmethyl)oxamide is Cc1cccc(C)c1N(Cn1cccn1)C(=O)C(N)=O.
What is the InChIKey of N'-(2,6-dimethylphenyl)-N'-(pyrazol-1-ylmethyl)oxamide?
The InChIKey is KKGLWAGKUHWHHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N4O2/c1-10-5-3-6-11(2)12(10)18(14(20)13(15)19)9-17-8-4-7-16-17/h3-8H,9H2,1-2H3,(H2,15,19).
What are the key properties of N'-(2,6-dimethylphenyl)-N'-(pyrazol-1-ylmethyl)oxamide?
N'-(2,6-dimethylphenyl)-N'-(pyrazol-1-ylmethyl)oxamide has a molecular weight of 272.31 g/mol, XLogP of 0.98, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(2,6-dimethylphenyl)-N'-(pyrazol-1-ylmethyl)oxamide is sourced from PubChem (CID 146170629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).