C15H17N3O2 — CID 146170630
N-(3-anilino-6,6-dimethyl-5,7-dihydro-2,1-benzoxazol-4-ylidene)hydroxylamine (PubChem CID 146170630) has the molecular formula C15H17N3O2 and a molecular weight of 271.32 g/mol. Its IUPAC name is N-(3-anilino-6,6-dimethyl-5,7-dihydro-2,1-benzoxazol-4-ylidene)hydroxylamine.
| Compound Name | N-(3-anilino-6,6-dimethyl-5,7-dihydro-2,1-benzoxazol-4-ylidene)hydroxylamine |
|---|---|
| PubChem CID | 146170630 |
| Molecular Formula | C15H17N3O2 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | N-(3-anilino-6,6-dimethyl-5,7-dihydro-2,1-benzoxazol-4-ylidene)hydroxylamine |
| SMILES | CC1(C)CC(=NO)c2c(noc2Nc2ccccc2)C1 |
| InChI | InChI=1S/C15H17N3O2/c1-15(2)8-11(17-19)13-12(9-15)18-20-14(13)16-10-6-4-3-5-7-10/h3-7,16,19H,8-9H2,1-2H3 |
| InChIKey | MQJZVPHQAODGNN-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 70.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|