C14H16N4O2S — CID 146170643
tert-butyl 5,12-dimethyl-10-thia-3,4,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene-11-carboxylate (PubChem CID 146170643) has the molecular formula C14H16N4O2S and a molecular weight of 304.38 g/mol. Its IUPAC name is tert-butyl 5,12-dimethyl-10-thia-3,4,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene-11-carboxylate.
| Compound Name | tert-butyl 5,12-dimethyl-10-thia-3,4,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene-11-carboxylate |
|---|---|
| PubChem CID | 146170643 |
| Molecular Formula | C14H16N4O2S |
| Molecular Weight | 304.38 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | tert-butyl 5,12-dimethyl-10-thia-3,4,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene-11-carboxylate |
| SMILES | Cc1c(C(=O)OC(C)(C)C)sc2ncn3c(C)nnc3c12 |
| InChI | InChI=1S/C14H16N4O2S/c1-7-9-11-17-16-8(2)18(11)6-15-12(9)21-10(7)13(19)20-14(3,4)5/h6H,1-5H3 |
| InChIKey | KIBWZQTUQICJNN-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 69.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.38 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |