C44H56 — CID 14617097
5,11,17,23-tetratert-butylpentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(25),3(28),4,6,9(27),10,12,15,17,19(26),21,23-dodecaene (PubChem CID 14617097) has the molecular formula C44H56 and a molecular weight of 584.93 g/mol. Its IUPAC name is 5,11,17,23-tetratert-butylpentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(25),3(28),4,6,9(27),10,12,15,17,19(26),21,23-dodecaene.
| Compound Name | 5,11,17,23-tetratert-butylpentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(25),3(28),4,6,9(27),10,12,15,17,19(26),21,23-dodecaene |
|---|---|
| PubChem CID | 14617097 |
| Molecular Formula | C44H56 |
| Molecular Weight | 584.93 g/mol |
| Exact Mass | 584.44 |
| IUPAC Name | 5,11,17,23-tetratert-butylpentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(25),3(28),4,6,9(27),10,12,15,17,19(26),21,23-dodecaene |
| SMILES | CC(C)(C)c1cc2cc(c1)Cc1cc(cc(C(C)(C)C)c1)Cc1cc(cc(C(C)(C)C)c1)Cc1cc(cc(C(C)(C)C)c1)C2 |
| InChI | InChI=1S/C44H56/c1-41(2,3)37-21-29-13-30(22-37)18-32-15-34(26-39(24-32)43(7,8)9)20-36-16-35(27-40(28-36)44(10,11)12)19-33-14-31(17-29)23-38(25-33)42(4,5)6/h13-16,21-28H,17-20H2,1-12H3 |
| InChIKey | YJEYJERXXIFDSA-UHFFFAOYSA-N |
| XLogP | 11.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.93 |
| LogP ≤ 5 | 11.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |