C21H21NO — CID 14617105
(4aS,7aR)-2-methyl-4,4-diphenyl-1,4a,7,7a-tetrahydrocyclopenta[c]pyridin-3-one (PubChem CID 14617105) has the molecular formula C21H21NO and a molecular weight of 303.41 g/mol. Its IUPAC name is (4aS,7aR)-2-methyl-4,4-diphenyl-1,4a,7,7a-tetrahydrocyclopenta[c]pyridin-3-one.
| Compound Name | (4aS,7aR)-2-methyl-4,4-diphenyl-1,4a,7,7a-tetrahydrocyclopenta[c]pyridin-3-one |
|---|---|
| PubChem CID | 14617105 |
| Molecular Formula | C21H21NO |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | (4aS,7aR)-2-methyl-4,4-diphenyl-1,4a,7,7a-tetrahydrocyclopenta[c]pyridin-3-one |
| SMILES | CN1C[C@@H]2CC=C[C@@H]2C(c2ccccc2)(c2ccccc2)C1=O |
| InChI | InChI=1S/C21H21NO/c1-22-15-16-9-8-14-19(16)21(20(22)23,17-10-4-2-5-11-17)18-12-6-3-7-13-18/h2-8,10-14,16,19H,9,15H2,1H3/t16-,19-/m0/s1 |
| InChIKey | ZUUPMEUYBSWGJQ-LPHOPBHVSA-N |
| XLogP | 3.64 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|