About 4-(butylsulfanylmethyl)-3,5-dimethyl-1H-pyrazole
4-(butylsulfanylmethyl)-3,5-dimethyl-1H-pyrazole (PubChem CID 146171340) has the molecular formula C10H18N2S
and a molecular weight of 198.33 g/mol. Its IUPAC name is 4-(butylsulfanylmethyl)-3,5-dimethyl-1H-pyrazole.
Molecular Properties
| Compound Name | 4-(butylsulfanylmethyl)-3,5-dimethyl-1H-pyrazole |
| PubChem CID | 146171340 |
| Molecular Formula | C10H18N2S |
| Molecular Weight | 198.33 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | 4-(butylsulfanylmethyl)-3,5-dimethyl-1H-pyrazole |
| SMILES | CCCCSCc1c(C)n[nH]c1C |
| InChI | InChI=1S/C10H18N2S/c1-4-5-6-13-7-10-8(2)11-12-9(10)3/h4-7H2,1-3H3,(H,11,12) |
| InChIKey | CXOGULRMGGYGBA-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.33 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(butylsulfanylmethyl)-3,5-dimethyl-1H-pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(butylsulfanylmethyl)-3,5-dimethyl-1H-pyrazole?
The IUPAC name of 4-(butylsulfanylmethyl)-3,5-dimethyl-1H-pyrazole (CID 146171340) is 4-(butylsulfanylmethyl)-3,5-dimethyl-1H-pyrazole.
What is the SMILES notation for 4-(butylsulfanylmethyl)-3,5-dimethyl-1H-pyrazole?
The canonical SMILES for 4-(butylsulfanylmethyl)-3,5-dimethyl-1H-pyrazole is CCCCSCc1c(C)n[nH]c1C.
What is the InChIKey of 4-(butylsulfanylmethyl)-3,5-dimethyl-1H-pyrazole?
The InChIKey is CXOGULRMGGYGBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2S/c1-4-5-6-13-7-10-8(2)11-12-9(10)3/h4-7H2,1-3H3,(H,11,12).
What are the key properties of 4-(butylsulfanylmethyl)-3,5-dimethyl-1H-pyrazole?
4-(butylsulfanylmethyl)-3,5-dimethyl-1H-pyrazole has a molecular weight of 198.33 g/mol, XLogP of 3.06, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(butylsulfanylmethyl)-3,5-dimethyl-1H-pyrazole is sourced from PubChem (CID 146171340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).