C10H17N5 — CID 146171356
1,2,2,3,4,9-hexadeuterio-8-(3-methylbut-3-enyl)purin-6-amine (PubChem CID 146171356) has the molecular formula C10H17N5 and a molecular weight of 213.32 g/mol. Its IUPAC name is 1,2,2,3,4,9-hexadeuterio-8-(3-methylbut-3-enyl)purin-6-amine.
| Compound Name | 1,2,2,3,4,9-hexadeuterio-8-(3-methylbut-3-enyl)purin-6-amine |
|---|---|
| PubChem CID | 146171356 |
| Molecular Formula | C10H17N5 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.19 |
| IUPAC Name | 1,2,2,3,4,9-hexadeuterio-8-(3-methylbut-3-enyl)purin-6-amine |
| SMILES | [2H]N1C(N)=C2N=C(CCC(=C)C)N([2H])C2([2H])N([2H])C1([2H])[2H] |
| InChI | InChI=1S/C10H17N5/c1-6(2)3-4-7-14-8-9(11)12-5-13-10(8)15-7/h10,12-13H,1,3-5,11H2,2H3,(H,14,15)/i5D2,10D/hD3 |
| InChIKey | FPYRHCGJYCBGSH-IKWCBQMISA-N |
| XLogP | -0.05 |
| TPSA | 74.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|