C7H6N4O7 — CID 146171375
methyl 3-(4-nitro-2-oxido-1,2,5-oxadiazol-2-ium-3-yl)-4,5-dihydro-1,2-oxazole-5-carboxylate (PubChem CID 146171375) has the molecular formula C7H6N4O7 and a molecular weight of 258.15 g/mol. Its IUPAC name is methyl 3-(4-nitro-2-oxido-1,2,5-oxadiazol-2-ium-3-yl)-4,5-dihydro-1,2-oxazole-5-carboxylate.
| Compound Name | methyl 3-(4-nitro-2-oxido-1,2,5-oxadiazol-2-ium-3-yl)-4,5-dihydro-1,2-oxazole-5-carboxylate |
|---|---|
| PubChem CID | 146171375 |
| Molecular Formula | C7H6N4O7 |
| Molecular Weight | 258.15 g/mol |
| Exact Mass | 258.02 |
| IUPAC Name | methyl 3-(4-nitro-2-oxido-1,2,5-oxadiazol-2-ium-3-yl)-4,5-dihydro-1,2-oxazole-5-carboxylate |
| SMILES | COC(=O)C1CC(c2c([N+](=O)[O-])no[n+]2[O-])=NO1 |
| InChI | InChI=1S/C7H6N4O7/c1-16-7(12)4-2-3(8-17-4)5-6(10(13)14)9-18-11(5)15/h4H,2H2,1H3 |
| InChIKey | SRTCXZHEXAXGEQ-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 144.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.15 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|