About N-[(E)-(2-nitrophenyl)methylideneamino]-4-phenyl-1,3-thiazol-3-ium-2-amine bromide
N-[(E)-(2-nitrophenyl)methylideneamino]-4-phenyl-1,3-thiazol-3-ium-2-amine bromide (PubChem CID 146171464) has the molecular formula C16H13BrN4O2S
and a molecular weight of 405.28 g/mol. Its IUPAC name is N-[(E)-(2-nitrophenyl)methylideneamino]-4-phenyl-1,3-thiazol-3-ium-2-amine bromide.
Molecular Properties
| Compound Name | N-[(E)-(2-nitrophenyl)methylideneamino]-4-phenyl-1,3-thiazol-3-ium-2-amine bromide |
| PubChem CID | 146171464 |
| Molecular Formula | C16H13BrN4O2S |
| Molecular Weight | 405.28 g/mol |
| Exact Mass | 403.99 |
| IUPAC Name | N-[(E)-(2-nitrophenyl)methylideneamino]-4-phenyl-1,3-thiazol-3-ium-2-amine bromide |
| SMILES | O=[N+]([O-])c1ccccc1/C=N/Nc1[nH+]c(-c2ccccc2)cs1.[Br-] |
| InChI | InChI=1S/C16H12N4O2S.BrH/c21-20(22)15-9-5-4-8-13(15)10-17-19-16-18-14(11-23-16)12-6-2-1-3-7-12;/h1-11H,(H,18,19);1H/b17-10+; |
| InChIKey | BUKLRQRLDLWAEH-LZMXEPDESA-N |
| XLogP | 0.59 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.28 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(E)-(2-nitrophenyl)methylideneamino]-4-phenyl-1,3-thiazol-3-ium-2-amine bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(E)-(2-nitrophenyl)methylideneamino]-4-phenyl-1,3-thiazol-3-ium-2-amine bromide?
The IUPAC name of N-[(E)-(2-nitrophenyl)methylideneamino]-4-phenyl-1,3-thiazol-3-ium-2-amine bromide (CID 146171464) is N-[(E)-(2-nitrophenyl)methylideneamino]-4-phenyl-1,3-thiazol-3-ium-2-amine bromide.
What is the SMILES notation for N-[(E)-(2-nitrophenyl)methylideneamino]-4-phenyl-1,3-thiazol-3-ium-2-amine bromide?
The canonical SMILES for N-[(E)-(2-nitrophenyl)methylideneamino]-4-phenyl-1,3-thiazol-3-ium-2-amine bromide is O=[N+]([O-])c1ccccc1/C=N/Nc1[nH+]c(-c2ccccc2)cs1.[Br-].
What is the InChIKey of N-[(E)-(2-nitrophenyl)methylideneamino]-4-phenyl-1,3-thiazol-3-ium-2-amine bromide?
The InChIKey is BUKLRQRLDLWAEH-LZMXEPDESA-N. The full InChI is InChI=1S/C16H12N4O2S.BrH/c21-20(22)15-9-5-4-8-13(15)10-17-19-16-18-14(11-23-16)12-6-2-1-3-7-12;/h1-11H,(H,18,19);1H/b17-10+;.
What are the key properties of N-[(E)-(2-nitrophenyl)methylideneamino]-4-phenyl-1,3-thiazol-3-ium-2-amine bromide?
N-[(E)-(2-nitrophenyl)methylideneamino]-4-phenyl-1,3-thiazol-3-ium-2-amine bromide has a molecular weight of 405.28 g/mol, XLogP of 0.59, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(E)-(2-nitrophenyl)methylideneamino]-4-phenyl-1,3-thiazol-3-ium-2-amine bromide is sourced from PubChem (CID 146171464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).