C24H31N7O — CID 146171722
N-methyl-N'-[[3-[5-methyl-4-(oxan-4-ylamino)-6-pyrimidin-5-ylpyrimidin-2-yl]phenyl]methyl]ethane-1,2-diamine (PubChem CID 146171722) has the molecular formula C24H31N7O and a molecular weight of 433.56 g/mol. Its IUPAC name is N-methyl-N'-[[3-[5-methyl-4-(oxan-4-ylamino)-6-pyrimidin-5-ylpyrimidin-2-yl]phenyl]methyl]ethane-1,2-diamine.
| Compound Name | N-methyl-N'-[[3-[5-methyl-4-(oxan-4-ylamino)-6-pyrimidin-5-ylpyrimidin-2-yl]phenyl]methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 146171722 |
| Molecular Formula | C24H31N7O |
| Molecular Weight | 433.56 g/mol |
| Exact Mass | 433.26 |
| IUPAC Name | N-methyl-N'-[[3-[5-methyl-4-(oxan-4-ylamino)-6-pyrimidin-5-ylpyrimidin-2-yl]phenyl]methyl]ethane-1,2-diamine |
| SMILES | CNCCNCc1cccc(-c2nc(NC3CCOCC3)c(C)c(-c3cncnc3)n2)c1 |
| InChI | InChI=1S/C24H31N7O/c1-17-22(20-14-27-16-28-15-20)30-24(31-23(17)29-21-6-10-32-11-7-21)19-5-3-4-18(12-19)13-26-9-8-25-2/h3-5,12,14-16,21,25-26H,6-11,13H2,1-2H3,(H,29,30,31) |
| InChIKey | MWDPZSYGSINQCZ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 96.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.56 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|