About 5-chloro-2-[(3S)-4,4-difluoro-3-methylpiperidin-1-yl]-1H-pyrimidin-6-one
5-chloro-2-[(3S)-4,4-difluoro-3-methylpiperidin-1-yl]-1H-pyrimidin-6-one (PubChem CID 146172003) has the molecular formula C10H12ClF2N3O
and a molecular weight of 263.67 g/mol. Its IUPAC name is 5-chloro-2-[(3S)-4,4-difluoro-3-methylpiperidin-1-yl]-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 5-chloro-2-[(3S)-4,4-difluoro-3-methylpiperidin-1-yl]-1H-pyrimidin-6-one |
| PubChem CID | 146172003 |
| Molecular Formula | C10H12ClF2N3O |
| Molecular Weight | 263.67 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | 5-chloro-2-[(3S)-4,4-difluoro-3-methylpiperidin-1-yl]-1H-pyrimidin-6-one |
| SMILES | C[C@H]1CN(c2ncc(Cl)c(=O)[nH]2)CCC1(F)F |
| InChI | InChI=1S/C10H12ClF2N3O/c1-6-5-16(3-2-10(6,12)13)9-14-4-7(11)8(17)15-9/h4,6H,2-3,5H2,1H3,(H,14,15,17)/t6-/m0/s1 |
| InChIKey | HYSFCBLRZWSYNK-LURJTMIESA-N |
| XLogP | 1.90 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.67 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-chloro-2-[(3S)-4,4-difluoro-3-methylpiperidin-1-yl]-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2-[(3S)-4,4-difluoro-3-methylpiperidin-1-yl]-1H-pyrimidin-6-one?
The IUPAC name of 5-chloro-2-[(3S)-4,4-difluoro-3-methylpiperidin-1-yl]-1H-pyrimidin-6-one (CID 146172003) is 5-chloro-2-[(3S)-4,4-difluoro-3-methylpiperidin-1-yl]-1H-pyrimidin-6-one.
What is the SMILES notation for 5-chloro-2-[(3S)-4,4-difluoro-3-methylpiperidin-1-yl]-1H-pyrimidin-6-one?
The canonical SMILES for 5-chloro-2-[(3S)-4,4-difluoro-3-methylpiperidin-1-yl]-1H-pyrimidin-6-one is C[C@H]1CN(c2ncc(Cl)c(=O)[nH]2)CCC1(F)F.
What is the InChIKey of 5-chloro-2-[(3S)-4,4-difluoro-3-methylpiperidin-1-yl]-1H-pyrimidin-6-one?
The InChIKey is HYSFCBLRZWSYNK-LURJTMIESA-N. The full InChI is InChI=1S/C10H12ClF2N3O/c1-6-5-16(3-2-10(6,12)13)9-14-4-7(11)8(17)15-9/h4,6H,2-3,5H2,1H3,(H,14,15,17)/t6-/m0/s1.
What are the key properties of 5-chloro-2-[(3S)-4,4-difluoro-3-methylpiperidin-1-yl]-1H-pyrimidin-6-one?
5-chloro-2-[(3S)-4,4-difluoro-3-methylpiperidin-1-yl]-1H-pyrimidin-6-one has a molecular weight of 263.67 g/mol, XLogP of 1.90, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2-[(3S)-4,4-difluoro-3-methylpiperidin-1-yl]-1H-pyrimidin-6-one is sourced from PubChem (CID 146172003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).