C12H13N5O2 — CID 146173085
3,4-dimethyl-5-N-(3-nitro-2-pyridinyl)pyridine-2,5-diamine (PubChem CID 146173085) has the molecular formula C12H13N5O2 and a molecular weight of 259.27 g/mol. Its IUPAC name is 3,4-dimethyl-5-N-(3-nitro-2-pyridinyl)pyridine-2,5-diamine.
| Compound Name | 3,4-dimethyl-5-N-(3-nitro-2-pyridinyl)pyridine-2,5-diamine |
|---|---|
| PubChem CID | 146173085 |
| Molecular Formula | C12H13N5O2 |
| Molecular Weight | 259.27 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | 3,4-dimethyl-5-N-(3-nitro-2-pyridinyl)pyridine-2,5-diamine |
| SMILES | Cc1c(Nc2ncccc2[N+](=O)[O-])cnc(N)c1C |
| InChI | InChI=1S/C12H13N5O2/c1-7-8(2)11(13)15-6-9(7)16-12-10(17(18)19)4-3-5-14-12/h3-6H,1-2H3,(H2,13,15)(H,14,16) |
| InChIKey | BRAGOGRNTOCZMP-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.27 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|