C29H47NO8 — CID 146173683
2-[(2S,3S,4E,6S,7S,10S)-2-[(2E,4E)-7-[butyl(methyl)carbamoyl]oxy-6-methylhepta-2,4-dien-2-yl]-7,10-dihydroxy-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl]acetic acid (PubChem CID 146173683) has the molecular formula C29H47NO8 and a molecular weight of 537.69 g/mol. Its IUPAC name is 2-[(2S,3S,4E,6S,7S,10S)-2-[(2E,4E)-7-[butyl(methyl)carbamoyl]oxy-6-methylhepta-2,4-dien-2-yl]-7,10-dihydroxy-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl]acetic acid.
| Compound Name | 2-[(2S,3S,4E,6S,7S,10S)-2-[(2E,4E)-7-[butyl(methyl)carbamoyl]oxy-6-methylhepta-2,4-dien-2-yl]-7,10-dihydroxy-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl]acetic acid |
|---|---|
| PubChem CID | 146173683 |
| Molecular Formula | C29H47NO8 |
| Molecular Weight | 537.69 g/mol |
| Exact Mass | 537.33 |
| IUPAC Name | 2-[(2S,3S,4E,6S,7S,10S)-2-[(2E,4E)-7-[butyl(methyl)carbamoyl]oxy-6-methylhepta-2,4-dien-2-yl]-7,10-dihydroxy-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl]acetic acid |
| SMILES | CCCCN(C)C(=O)OCC(C)/C=C/C=C(\C)[C@H]1OC(=O)C[C@@H](O)CC[C@](C)(O)[C@@H](CC(=O)O)/C=C/[C@@H]1C |
| InChI | InChI=1S/C29H47NO8/c1-7-8-16-30(6)28(35)37-19-20(2)10-9-11-21(3)27-22(4)12-13-23(17-25(32)33)29(5,36)15-14-24(31)18-26(34)38-27/h9-13,20,22-24,27,31,36H,7-8,14-19H2,1-6H3,(H,32,33)/b10-9+,13-12+,21-11+/t20?,22-,23+,24-,27+,29-/m0/s1 |
| InChIKey | PHBBUILOWGMAHV-GMVQHLTOSA-N |
| XLogP | 4.48 |
| TPSA | 133.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.69 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|